On Target PLP_SARS 0.20103092/CHEMBL212080
For the given ligand DB09050, we have found in our database that, being scored 0.20103092, the most similar ligand is CHEMBL212080. Check out the elaboration below.
| DB09050 (Given Ligand) | CHEMBL212080 (Similar Ligand) |
|---|---|
| Cn1c(N)c(NC(=O)NCCN)c[n+]1C/C4=C(C(=O)[O-])/N3C(=O)[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c2nsc(N)n2)[C@H]3SC4 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)OC(C)(C)C |
|
|
|
|
|
|
| 04400087 c2806858 a0534200 0c310f60 01090088 98002000 c22c032c 9022a50d 1338a581 9a07c2c1 012b968d 600df941 8e01f886 00ac2105 851f0087 004c405c 74e00d01 08c443c0 21c10018 0372272c c0008580 b9018f92 af9a7b01 16400018 45001202 2c400f24 40c54020 c40605d8 0c00100c e0463123 24087091 a3b383e8 | 01030000 0140f000 00100100 84010600 00040080 0023c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 1e028002 00092001 80001408 021a0008 20220000 02080500 20812890 01001201 00002020 38040fb0 13008083 02500018 00001401 8800ac02 00c84800 90200120 08000200 00060001 ec004000 02802210 |