On Target NS3_HCV1A 0.33333334/CHEMBL4108323
For the given ligand DB00997, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL4108323. Check out the elaboration below.
| DB00997 (Given Ligand) | CHEMBL4108323 (Similar Ligand) |
|---|---|
| COc4cccc5c(=O)c3c(O)c2C[C@](O)(C(=O)CO)C[C@H](O[C@H]1C[C@@H](N)[C@@H](O)[C@H](C)O1)c2c(O)c3c(=O)c45 | COc1cc(C(=O)c2c(Cl)ccc([C@H](N)C3CC3)c2F)ccc1C#N |
|
|
|
|
|
|
| 00050040 4b000808 2000050a 40050700 88281051 4002c402 17103c40 09000a01 00200900 01080ae8 2c100000 4000db40 04008002 22a90000 01044021 2a28b008 08a00a00 02000100 11d8a008 40020201 00101520 b8020260 07004068 0a420414 00000c00 e0002201 00080800 64800024 02000383 00074802 c2e00004 02400400 | 00008044 43000808 2010010a 42010600 00001221 00000010 22000000 01001000 00000900 00880ec0 08100000 40808a00 02008866 21201004 01004001 28082008 03400200 03000000 00880400 00020201 00000502 18028300 01000400 10420014 00002000 a0000200 08040000 40800081 00000380 00068422 84040000 00020600 |