On Target ACE2_HUMAN 0.2824074/CHEMBL252003
For the given ligand DB00254, we have found in our database that, being scored 0.2824074, the most similar ligand is CHEMBL252003. Check out the elaboration below.
| DB00254 (Given Ligand) | CHEMBL252003 (Similar Ligand) |
|---|---|
| C[C@@H]4c1cccc(O)c1C(=O)/C3=C(O)/[C@@]2(O)C(=O)/C(C(N)=O)=C(O)\[C@H](N(C)C)[C@H]2[C@@H](O)[C@H]34 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1cccc(Oc2ccccc2)c1)C(=O)O |
|
|
|
|
|
|
| 00070030 c3008808 22901b02 0031060a 00390080 40828003 020010c1 28000e03 91040940 00d888ca 08300200 4041d040 9c02812a 03a10000 00000424 00082108 20004600 02100120 01e52010 00032a01 00400100 180207d0 0700c0c0 00540014 00201000 88004401 00404200 90000080 04004002 00064002 b4020000 00c10e00 | 00010000 43005008 20100108 00110600 00001080 c0000000 82000000 20000004 00000880 020a08c0 08300000 4001b000 06008002 20040000 81080001 00080008 10000000 02000000 00482008 00020201 00400100 18200e00 03000140 85500018 00000800 80000000 00000000 10200040 04000280 00060003 20004400 03012600 |