On Target ACE2_HUMAN 0.18292683/CHEMBL254900
For the given ligand DB00917, we have found in our database that, being scored 0.18292683, the most similar ligand is CHEMBL254900. Check out the elaboration below.
| DB00917 (Given Ligand) | CHEMBL254900 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)/C=C/[C@H]1[C@@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](C)C(=O)O |
|
|
|
|
|
|
| 00050000 01000000 00000800 00000000 00080000 00000000 00000000 28000402 00000000 00108008 00000200 40001000 14028008 00800000 00000404 00080008 00000000 00000000 00402010 02000001 00000000 00000a00 01008000 00000010 00201000 00000400 00404200 80000000 00000000 81000000 24020000 00000000 | 00010000 01004000 00100000 00100400 00000080 00000000 80000000 20000000 00000000 02080080 00200000 40013000 06008002 00040000 80080000 00080008 10000000 00000000 00000000 00000201 00000000 10000e00 03000100 04100018 00000000 00000000 00000000 10000040 00000000 00040001 20004000 03010200 |