On Target ACE2_HUMAN 0.2907489/CHEMBL254493
For the given ligand DB00997, we have found in our database that, being scored 0.2907489, the most similar ligand is CHEMBL254493. Check out the elaboration below.
| DB00997 (Given Ligand) | CHEMBL254493 (Similar Ligand) |
|---|---|
| COc4cccc5c(=O)c3c(O)c2C[C@](O)(C(=O)CO)C[C@H](O[C@H]1C[C@@H](N)[C@@H](O)[C@H](C)O1)c2c(O)c3c(=O)c45 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccccc1OCc1ccccc1)C(=O)O |
|
|
|
|
|
|
| 00050040 4b000808 2000050a 40050700 88281051 4002c402 17103c40 09000a01 00200900 01080ae8 2c100000 4000db40 04008002 22a90000 01044021 2a28b008 08a00a00 02000100 11d8a008 40020201 00101520 b8020260 07004068 0a420414 00000c00 e0002201 00080800 64800024 02000383 00074802 c2e00004 02400400 | 04010000 01005008 20100108 00110600 00001080 80004000 86000000 20000204 00000980 020a08c0 08300000 4001b0c0 06808002 00050000 81080001 02082008 90000000 02008000 00400008 00020201 00000100 18200e20 03000140 85d01418 00004800 c0002000 00000000 10000040 04000300 00070003 60004000 03012600 |