On Target NS3_HCV1B 0.28994083/CHEMBL297884
For the given ligand DB00254, we have found in our database that, being scored 0.28994083, the most similar ligand is CHEMBL297884. Check out the elaboration below.
| DB00254 (Given Ligand) | CHEMBL297884 (Similar Ligand) |
|---|---|
| C[C@@H]4c1cccc(O)c1C(=O)/C3=C(O)/[C@@]2(O)C(=O)/C(C(N)=O)=C(O)\[C@H](N(C)C)[C@H]2[C@@H](O)[C@H]34 | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCC[C@H](NC(=O)OC5CCCC5)C(=O)N4C3)cc(-c3csc(NC(C)C)n3)nc2c1 |
|
|
|
|
|
|
| 00070030 c3008808 22901b02 0031060a 00390080 40828003 020010c1 28000e03 91040940 00d888ca 08300200 4041d040 9c02812a 03a10000 00000424 00082108 20004600 02100120 01e52010 00032a01 00400100 180207d0 0700c0c0 00540014 00201000 88004401 00404200 90000080 04004002 00064002 b4020000 00c10e00 | 04072002 c9427008 a0104908 14810702 211c10a0 02118050 c6080100 b00a848a 10800300 2010c8ca 00202a04 5101b420 0e82881a 01502183 911a3441 021e200c 10a24000 120861c4 44e82818 12e63a01 40080000 3914aef8 f390c883 82510018 00a01081 8c101002 00e04240 90200465 0c00420c 850e2403 e4065800 04252a42 |