On Target PR_HIV1 0.272/CHEMBL492666
For the given ligand DB00254, we have found in our database that, being scored 0.272, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| DB00254 (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| C[C@@H]4c1cccc(O)c1C(=O)/C3=C(O)/[C@@]2(O)C(=O)/C(C(N)=O)=C(O)\[C@H](N(C)C)[C@H]2[C@@H](O)[C@H]34 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00070030 c3008808 22901b02 0031060a 00390080 40828003 020010c1 28000e03 91040940 00d888ca 08300200 4041d040 9c02812a 03a10000 00000424 00082108 20004600 02100120 01e52010 00032a01 00400100 180207d0 0700c0c0 00540014 00201000 88004401 00404200 90000080 04004002 00064002 b4020000 00c10e00 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |