On Target PR_HIV1 0.0867052/CHEMBL492666
For the given ligand DB00917, we have found in our database that, being scored 0.0867052, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| DB00917 (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)/C=C/[C@H]1[C@@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00050000 01000000 00000800 00000000 00080000 00000000 00000000 28000402 00000000 00108008 00000200 40001000 14028008 00800000 00000404 00080008 00000000 00000000 00402010 02000001 00000000 00000a00 01008000 00000010 00201000 00000400 00404200 80000000 00000000 81000000 24020000 00000000 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |