On Target PR_HIV1 0.2669173/CHEMBL3645125
For the given ligand DB00997, we have found in our database that, being scored 0.2669173, the most similar ligand is CHEMBL3645125. Check out the elaboration below.
| DB00997 (Given Ligand) | CHEMBL3645125 (Similar Ligand) |
|---|---|
| COc4cccc5c(=O)c3c(O)c2C[C@](O)(C(=O)CO)C[C@H](O[C@H]1C[C@@H](N)[C@@H](O)[C@H](C)O1)c2c(O)c3c(=O)c45 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CC3OCOCO[C@@H]3C2)cc1 |
|
|
|
|
|
|
| 00050040 4b000808 2000050a 40050700 88281051 4002c402 17103c40 09000a01 00200900 01080ae8 2c100000 4000db40 04008002 22a90000 01044021 2a28b008 08a00a00 02000100 11d8a008 40020201 00101520 b8020260 07004068 0a420414 00000c00 e0002201 00080800 64800024 02000383 00074802 c2e00004 02400400 | 00000010 01c05408 2110010a 01b10700 00281080 00028000 02002800 a0000004 00742a00 014809e0 08302000 60018000 00008002 02200101 81e80001 003a0008 10822000 02080000 11408800 81027603 80100100 18280c90 07100040 d9500058 02000000 8000100e 00800000 3420008c 04000600 2106001b 80a00000 00012670 |