On Target RT_HIV1 0.37198067/CHEMBL4225865
For the given ligand DB00254, we have found in our database that, being scored 0.37198067, the most similar ligand is CHEMBL4225865. Check out the elaboration below.
| DB00254 (Given Ligand) | CHEMBL4225865 (Similar Ligand) |
|---|---|
| C[C@@H]4c1cccc(O)c1C(=O)/C3=C(O)/[C@@]2(O)C(=O)/C(C(N)=O)=C(O)\[C@H](N(C)C)[C@H]2[C@@H](O)[C@H]34 | C=C(C)[C@@H]1CC[C@]2(CN(CCN(C)C)C(=O)CCC(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00070030 c3008808 22901b02 0031060a 00390080 40828003 020010c1 28000e03 91040940 00d888ca 08300200 4041d040 9c02812a 03a10000 00000424 00082108 20004600 02100120 01e52010 00032a01 00400100 180207d0 0700c0c0 00540014 00201000 88004401 00404200 90000080 04004002 00064002 b4020000 00c10e00 | 00060000 01003800 00100302 44050600 00100000 00004000 80000080 2000040a 00000900 001808c0 08300000 40019800 04028002 00202000 00000402 00080008 00000400 02000020 02412000 00000201 01000100 38060e30 01008021 0250001c 01200000 80000000 00406000 d0000000 08400002 01060003 e4020000 00802e00 |