On Target RT_HIV1 0.2905983/CHEMBL4227326
For the given ligand DB00734, we have found in our database that, being scored 0.2905983, the most similar ligand is CHEMBL4227326. Check out the elaboration below.
| DB00734 (Given Ligand) | CHEMBL4227326 (Similar Ligand) |
|---|---|
| Cc2nc1CCCCn1c(=O)c2CCN5CCC(c3noc4cc(F)ccc34)CC5 | C=C(C)[C@@H]1CC[C@]2(CNCCc3ccccn3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 0000008a 01002a00 001a1100 33054618 000c0222 00104050 01003820 20008410 06420980 900918f0 2830840c 50818800 00009082 02f09040 00020080 200c0804 01008200 86838002 00600008 40800201 84a02104 18210018 21c04041 10780594 00040000 c0010000 20000030 18041185 04204005 01c7820a 40280084 e00026b8 | 0400000a 01000800 00104322 50050600 00040020 00004000 80000080 20000402 00000980 00180ac0 08308004 40818800 00028802 00200000 01020402 020c000c 00000400 0a000020 02212000 00000201 41000100 18228a30 20808020 81500014 01201000 80000000 00406040 d0000000 04400006 01060002 e4020000 20002600 |