On Target NS5B_HCV1A 0.29107982/CHEMBL446360
For the given ligand DB00254, we have found in our database that, being scored 0.29107982, the most similar ligand is CHEMBL446360. Check out the elaboration below.
| DB00254 (Given Ligand) | CHEMBL446360 (Similar Ligand) |
|---|---|
| C[C@@H]4c1cccc(O)c1C(=O)/C3=C(O)/[C@@]2(O)C(=O)/C(C(N)=O)=C(O)\[C@H](N(C)C)[C@H]2[C@@H](O)[C@H]34 | N#Cc1ccc(Br)cc1Oc1ccccc1C(=O)CC(=O)C(=O)O |
|
|
|
|
|
|
| 00070030 c3008808 22901b02 0031060a 00390080 40828003 020010c1 28000e03 91040940 00d888ca 08300200 4041d040 9c02812a 03a10000 00000424 00082108 20004600 02100120 01e52010 00032a01 00400100 180207d0 0700c0c0 00540014 00201000 88004401 00404200 90000080 04004002 00064002 b4020000 00c10e00 | 00054004 01008808 2000010a 00018200 00081020 00020002 06404000 00000201 04000904 00880840 0814000a 4000d040 04008012 00200000 01000001 00082008 00400000 02000000 00c02008 00020001 00400100 08020a00 01000400 00400414 00000800 c0000000 00120800 00200000 00000302 00064422 81020408 08400400 |