On Target NS5B_HCV1B 0.28947368/CHEMBL3645202
For the given ligand DB00254, we have found in our database that, being scored 0.28947368, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| DB00254 (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| C[C@@H]4c1cccc(O)c1C(=O)/C3=C(O)/[C@@]2(O)C(=O)/C(C(N)=O)=C(O)\[C@H](N(C)C)[C@H]2[C@@H](O)[C@H]34 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00070030 c3008808 22901b02 0031060a 00390080 40828003 020010c1 28000e03 91040940 00d888ca 08300200 4041d040 9c02812a 03a10000 00000424 00082108 20004600 02100120 01e52010 00032a01 00400100 180207d0 0700c0c0 00540014 00201000 88004401 00404200 90000080 04004002 00064002 b4020000 00c10e00 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |