On Target NS5B_HCV1B 0.30094042/CHEMBL3645193
For the given ligand DB00734, we have found in our database that, being scored 0.30094042, the most similar ligand is CHEMBL3645193. Check out the elaboration below.
| DB00734 (Given Ligand) | CHEMBL3645193 (Similar Ligand) |
|---|---|
| Cc2nc1CCCCn1c(=O)c2CCN5CCC(c3noc4cc(F)ccc34)CC5 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3ncoc3C)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 0000008a 01002a00 001a1100 33054618 000c0222 00104050 01003820 20008410 06420980 900918f0 2830840c 50818800 00009082 02f09040 00020080 200c0804 01008200 86838002 00600008 40800201 84a02104 18210018 21c04041 10780594 00040000 c0010000 20000030 18041185 04204005 01c7820a 40280084 e00026b8 | 00004006 0080de18 20180902 51310e10 210d0001 0010c042 02050400 02003419 00104900 004909f0 09392024 40118c02 80008c33 01600201 808a4440 240e200e 04268000 02010006 08602008 40225203 e4120101 1c8b8e38 2080c800 9770001c 02144084 e0004048 04274080 9804108c 0c488104 0046005b e4068088 a81147e0 |