On Target NA_INFB 0.34199134/CHEMBL365976
For the given ligand DB00734, we have found in our database that, being scored 0.34199134, the most similar ligand is CHEMBL365976. Check out the elaboration below.
| DB00734 (Given Ligand) | CHEMBL365976 (Similar Ligand) |
|---|---|
| Cc2nc1CCCCn1c(=O)c2CCN5CCC(c3noc4cc(F)ccc34)CC5 | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1ccon1 |
|
|
|
|
|
|
| 0000008a 01002a00 001a1100 33054618 000c0222 00104050 01003820 20008410 06420980 900918f0 2830840c 50818800 00009082 02f09040 00020080 200c0804 01008200 86838002 00600008 40800201 84a02104 18210018 21c04041 10780594 00040000 c0010000 20000030 18041185 04204005 01c7820a 40280084 e00026b8 | 04010000 01003200 001a0102 2600c600 00080680 00100010 00000020 20040408 00020880 00080080 00308000 40013000 0600801a 01a03041 81180000 200c000c 11000200 0e010002 00402000 00800201 00902006 30240e30 03800001 03180098 00000000 00000000 00000020 18000181 0c200006 0006000b 00024000 40c02e00 |