On Target RDRP_SARS2 0.06271777/CHEMBL4065616
For the given ligand DB00917, we have found in our database that, being scored 0.06271777, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| DB00917 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)/C=C/[C@H]1[C@@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 00050000 01000000 00000800 00000000 00080000 00000000 00000000 28000402 00000000 00108008 00000200 40001000 14028008 00800000 00000404 00080008 00000000 00000000 00402010 02000001 00000000 00000a00 01008000 00000010 00201000 00000400 00404200 80000000 00000000 81000000 24020000 00000000 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |