On Target RDRP_SARS2 0.21763085/CHEMBL4065616
For the given ligand DB00734, we have found in our database that, being scored 0.21763085, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| DB00734 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| Cc2nc1CCCCn1c(=O)c2CCN5CCC(c3noc4cc(F)ccc34)CC5 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 0000008a 01002a00 001a1100 33054618 000c0222 00104050 01003820 20008410 06420980 900918f0 2830840c 50818800 00009082 02f09040 00020080 200c0804 01008200 86838002 00600008 40800201 84a02104 18210018 21c04041 10780594 00040000 c0010000 20000030 18041185 04204005 01c7820a 40280084 e00026b8 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |