On Target NSP15_SARS 0.33333334/CHEMBL1092796
For the given ligand DB00917, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL1092796. Check out the elaboration below.
| DB00917 (Given Ligand) | CHEMBL1092796 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)/C=C/[C@H]1[C@@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O | CC1=CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
|
|
|
|
|
|
| 00050000 01000000 00000800 00000000 00080000 00000000 00000000 28000402 00000000 00108008 00000200 40001000 14028008 00800000 00000404 00080008 00000000 00000000 00402010 02000001 00000000 00000a00 01008000 00000010 00201000 00000400 00404200 80000000 00000000 81000000 24020000 00000000 | 00000402 01040000 00000800 00080000 40402000 00000001 00000080 02000402 01000000 00100000 00000200 40404200 80028000 20000000 00000404 0008040c 00000000 00000020 02092080 00020001 00002001 00000280 01008000 00000812 00200000 00000000 00404240 80800000 00004000 00000000 24820000 04000000 |