On Target NP_HCoV-OC43 0.08071749/CHEMBL3233481
For the given ligand DB00254, we have found in our database that, being scored 0.08071749, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| DB00254 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C[C@@H]4c1cccc(O)c1C(=O)/C3=C(O)/[C@@]2(O)C(=O)/C(C(N)=O)=C(O)\[C@H](N(C)C)[C@H]2[C@@H](O)[C@H]34 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00070030 c3008808 22901b02 0031060a 00390080 40828003 020010c1 28000e03 91040940 00d888ca 08300200 4041d040 9c02812a 03a10000 00000424 00082108 20004600 02100120 01e52010 00032a01 00400100 180207d0 0700c0c0 00540014 00201000 88004401 00404200 90000080 04004002 00064002 b4020000 00c10e00 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |