On Target NP_HCoV-OC43 0.14285715/CHEMBL3233481
For the given ligand DB00734, we have found in our database that, being scored 0.14285715, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| DB00734 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Cc2nc1CCCCn1c(=O)c2CCN5CCC(c3noc4cc(F)ccc34)CC5 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0000008a 01002a00 001a1100 33054618 000c0222 00104050 01003820 20008410 06420980 900918f0 2830840c 50818800 00009082 02f09040 00020080 200c0804 01008200 86838002 00600008 40800201 84a02104 18210018 21c04041 10780594 00040000 c0010000 20000030 18041185 04204005 01c7820a 40280084 e00026b8 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |