On Target PLP_SARS 0.19863014/CHEMBL213543
For the given ligand DB00917, we have found in our database that, being scored 0.19863014, the most similar ligand is CHEMBL213543. Check out the elaboration below.
| DB00917 (Given Ligand) | CHEMBL213543 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)/C=C/[C@H]1[C@@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
|
|
|
|
|
|
| 00050000 01000000 00000800 00000000 00080000 00000000 00000000 28000402 00000000 00108008 00000200 40001000 14028008 00800000 00000404 00080008 00000000 00000000 00402010 02000001 00000000 00000a00 01008000 00000010 00201000 00000400 00404200 80000000 00000000 81000000 24020000 00000000 | 01030000 0140b000 00100100 04010600 00000000 0001c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 0e028002 00012001 80000400 021a0008 20020000 02080500 20012890 00001201 00002000 38040fb0 00008003 02500018 00001400 8800ac02 00484000 90200120 08000200 00060001 ec004000 02802210 |