On Target PLP_SARS 0.21090908/CHEMBL190743
For the given ligand DB00734, we have found in our database that, being scored 0.21090908, the most similar ligand is CHEMBL190743. Check out the elaboration below.
| DB00734 (Given Ligand) | CHEMBL190743 (Similar Ligand) |
|---|---|
| Cc2nc1CCCCn1c(=O)c2CCN5CCC(c3noc4cc(F)ccc34)CC5 | O=C1C(=O)N(Cc2cc3ccccc3s2)c2ccc(I)cc21 |
|
|
|
|
|
|
| 0000008a 01002a00 001a1100 33054618 000c0222 00104050 01003820 20008410 06420980 900918f0 2830840c 50818800 00009082 02f09040 00020080 200c0804 01008200 86838002 00600008 40800201 84a02104 18210018 21c04041 10780594 00040000 c0010000 20000030 18041185 04204005 01c7820a 40280084 e00026b8 | 1001c002 55c00800 22100100 00010600 300c8000 00010040 00000080 02085002 04800081 000808c0 08280204 4001f080 03008852 02100020 400225c0 00000010 00049000 0200000c 08200100 00000208 c0111440 58228688 20012080 8144001d 02000002 c4010282 00800010 80001084 04088300 00068403 a0247000 20c10600 |