On Target NSP1_SARS 0.22881356/CHEMBL1092796
For the given ligand DB00511, we have found in our database that, being scored 0.22881356, the most similar ligand is CHEMBL1092796. Check out the elaboration below.
| DB00511 (Given Ligand) | CHEMBL1092796 (Similar Ligand) |
|---|---|
| CC(=O)O[C@H]8C[C@@H](O[C@@H]7[C@@H](C)O[C@@H](O[C@H]6[C@H](C)O[C@H](O[C@@H]5CC[C@]1(C)[C@@H](CC[C@@H]3[C@@H]1CC[C@@]4(C)[C@@H](/C2=C/C(=O)OC2)CC[C@]34O)C5)C[C@H]6O)C[C@@H]7O)O[C@@H](C)[C@H]8O | CC1=CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
|
|
|
|
|
|
| 00000040 81000000 00000500 00810300 80280040 00000800 00002880 08000440 01202000 01100028 40000000 40008000 00028000 02800000 00000400 00289008 00820010 00000000 1341a010 00002001 00100020 10000a80 05008000 08000010 00001400 00000400 00404000 a4000020 00000200 0100000a 24a20000 00800010 | 00000402 01040000 00000800 00080000 40402000 00000001 00000080 02000402 01000000 00100000 00000200 40404200 80028000 20000000 00000404 0008040c 00000000 00000020 02092080 00020001 00002001 00000280 01008000 00000812 00200000 00000000 00404240 80800000 00004000 00000000 24820000 04000000 |