On Target NS3_HCV1A 0.42307693/CHEMBL3645743
For the given ligand DB06288, we have found in our database that, being scored 0.42307693, the most similar ligand is CHEMBL3645743. Check out the elaboration below.
| DB06288 (Given Ligand) | CHEMBL3645743 (Similar Ligand) |
|---|---|
| CCN1CCC[C@H]1CNC(=O)c2cc(S(=O)(=O)CC)c(N)cc2OC | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1cc3cc(OC)ccc3[nH]1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00000002 85807a08 a0124108 84910600 00001120 00030110 02000000 22001408 01020000 001148c0 08602005 60018040 00008802 08042000 812004c1 00002008 04000100 02000000 00010400 00022601 c0000000 38068620 20800021 0a58001d 00004000 c0000000 00800800 90000080 08000300 00060001 b4040000 40010220 | 000180a2 0900b808 26100108 15210e00 00041020 00100010 060a0000 22003409 10000000 0011c9c8 00692004 4001b000 0601881e 01502011 a1420441 0204010c 04004000 02000006 46212000 00024201 40000000 38078638 20802003 b2d0003c 00102000 c0000000 00000000 90000010 08000304 c0060081 e4064204 00016260 |