On Target NS3_HCV1A 0.34810126/CHEMBL3645697
For the given ligand DB01256, we have found in our database that, being scored 0.34810126, the most similar ligand is CHEMBL3645697. Check out the elaboration below.
| DB01256 (Given Ligand) | CHEMBL3645697 (Similar Ligand) |
|---|---|
| C=C[C@]5(C)C[C@@H](OC(=O)CS[C@H]1C[C@@H]2CC[C@H](C1)N2C)[C@@]3(C)[C@@H](C)CC[C@@]4(CCC(=O)[C@@H]34)[C@H](C)[C@H]5O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]1CCCCN1C(C)C)C1CCCCC1)C1(C)CCOCC1)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00050000 81000000 00100101 80110740 00290000 00000030 00000000 20000400 04200000 001040c0 00203000 50079000 0401802a 80840000 00000414 00081008 04820000 00000100 12402000 00000201 40000020 10000a12 01000300 00300010 08008400 00000010 00000000 90003040 00000200 01040022 24020000 05012200 | 000100a0 09003000 06100000 05210500 80180000 00000010 000a0000 20001408 10000000 0010c188 00602000 5001b000 0601803a 01002011 a0400400 00081008 04804000 00000000 46412000 00004201 00000020 30040630 01000003 32900038 00000400 00000000 00000200 90000010 08000200 c0040081 64024004 00012a60 |