On Target NS3_HCV1A 0.29268292/CHEMBL4106916
For the given ligand DB09164, we have found in our database that, being scored 0.29268292, the most similar ligand is CHEMBL4106916. Check out the elaboration below.
| DB09164 (Given Ligand) | CHEMBL4106916 (Similar Ligand) |
|---|---|
| CC(C)c1cccc(C(C)C)c1NC(=O)CN(CC(=O)O)CC(=O)O | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2ccc3c(c2)OCC(=O)N3)c1F |
|
|
|
|
|
|
| 00004002 00000000 00000120 04010600 00000081 00000040 00000000 00000000 00000000 00080a40 08282024 4000a000 02008002 00102003 00320040 00080008 10248000 02000000 08000000 00000000 40100000 28000e00 22002000 02400012 00000000 80000000 00000010 00801080 08088000 00060003 00004000 20000600 | 0400e042 42000808 20101108 c2010602 80001281 00000010 22000000 01001000 00020800 00080e40 083c0004 4000ca00 02808866 20109084 01005041 28084408 03040200 83000000 08080400 00020201 41100500 18068700 33002000 10428014 00002000 a0000200 28040048 40800081 00008280 00068003 84040000 00020600 |