On Target NS3_HCV1A 0.25795054/CHEMBL3953262
For the given ligand DB13279, we have found in our database that, being scored 0.25795054, the most similar ligand is CHEMBL3953262. Check out the elaboration below.
| DB13279 (Given Ligand) | CHEMBL3953262 (Similar Ligand) |
|---|---|
| CCOC(=O)COc2ccc1c(C)c(CCN(CC)CC)c(=O)oc1c2 | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)S(C)(=O)=O)c(-c3ccc4c(c3)-c3[nH]c5ccccc5c3C(C)(C)O4)cc12 |
|
|
|
|
|
|
| 04000040 00202008 20180108 00010600 00051233 00400120 02000000 40000250 020a6080 40080840 0c240020 4040c000 40808402 00200080 01208081 10080808 00020220 82000040 08000002 00020200 00004000 1a200a08 04204008 89580010 08000410 80004000 00000039 0a900030 46002200 01060802 00000000 00000600 | 0c41a002 00200809 2018090a 52310612 0a841221 0800c110 02252000 42aa3200 10474100 10480840 8c20a124 40108c00 c2808c13 00619081 e12a4c61 220e200c 00064001 0203b804 0e210602 10524022 402e0008 3a028e2e f0804020 80c85014 0884608c 80006000 3c420014 988010cd 0040e305 11068403 c0040a40 00010660 |