On Target NS3_HCV1B 0.28476822/CHEMBL3927196
For the given ligand DB01256, we have found in our database that, being scored 0.28476822, the most similar ligand is CHEMBL3927196. Check out the elaboration below.
| DB01256 (Given Ligand) | CHEMBL3927196 (Similar Ligand) |
|---|---|
| C=C[C@]5(C)C[C@@H](OC(=O)CS[C@H]1C[C@@H]2CC[C@H](C1)N2C)[C@@]3(C)[C@@H](C)CC[C@@]4(CCC(=O)[C@@H]34)[C@H](C)[C@H]5O | CC(C)=CC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC2[C@@H]([C@H]1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C2(C)C |
|
|
|
|
|
|
| 00050000 81000000 00100101 80110740 00290000 00000030 00000000 20000400 04200000 001040c0 00203000 50079000 0401802a 80840000 00000414 00081008 04820000 00000100 12402000 00000201 40000020 10000a12 01000300 00300010 08008400 00000010 00000000 90003040 00000200 01040022 24020000 05012200 | 00030000 01403400 00100000 04000600 00000000 00018010 00000000 20000408 05800200 00120180 00200000 5001b000 0e02801a 01002011 80000400 001a0008 00020000 00080001 00012810 00000201 00000000 300c0e70 00008003 02100018 00001000 00000002 00404000 90200020 08000200 00040011 a4024000 00802200 |