On Target PA_INFA 0.2849162/CHEMBL2068712
For the given ligand DB06288, we have found in our database that, being scored 0.2849162, the most similar ligand is CHEMBL2068712. Check out the elaboration below.
| DB06288 (Given Ligand) | CHEMBL2068712 (Similar Ligand) |
|---|---|
| CCN1CCC[C@H]1CNC(=O)c2cc(S(=O)(=O)CC)c(N)cc2OC | O=C([O-])C(=O)/C=C(\[O-])C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1.[Zn+2] |
|
|
|
|
|
|
| 00000002 85807a08 a0124108 84910600 00001120 00030110 02000000 22001408 01020000 001148c0 08602005 60018040 00008802 08042000 812004c1 00002008 04000100 02000000 00010400 00022601 c0000000 38068620 20800021 0a58001d 00004000 c0000000 00800800 90000080 08000300 00060001 b4040000 40010220 | 00008000 01000000 00900902 00110600 00100000 00000000 000001c0 22001402 15100840 001808c2 08300200 5001d800 82028826 00200000 00000404 00080008 00004000 02000000 00450000 00000201 00000100 18008b80 01008040 00500010 00202000 c0000000 00440000 90000000 04004100 00060002 34040000 40030e00 |