On Target PA_INFA 0.42990655/CHEMBL2040552
For the given ligand DB09164, we have found in our database that, being scored 0.42990655, the most similar ligand is CHEMBL2040552. Check out the elaboration below.
| DB09164 (Given Ligand) | CHEMBL2040552 (Similar Ligand) |
|---|---|
| CC(C)c1cccc(C(C)C)c1NC(=O)CN(CC(=O)O)CC(=O)O | O=C(O)/C(O)=C/C(=O)c1ccc(N2CCNCC2)cc1 |
|
|
|
|
|
|
| 00004002 00000000 00000120 04010600 00000081 00000040 00000000 00000000 00000000 00080a40 08282024 4000a000 02008002 00102003 00320040 00080008 10248000 02000000 08000000 00000000 40100000 28000e00 22002000 02400012 00000000 80000000 00000010 00801080 08088000 00060003 00004000 20000600 | 00004002 00000800 00000120 c4010600 00000000 00800000 00000001 00000400 01000000 00980a40 08200004 4000c000 80008002 0000a000 00000040 00080008 00040400 02100000 08250010 00000800 40100000 38020a80 24008020 02400016 00001000 84004400 00400000 00000080 0800c000 00060002 84000000 00000600 |