On Target PR_HIV1 0.24545455/CHEMBL494499
For the given ligand DB13279, we have found in our database that, being scored 0.24545455, the most similar ligand is CHEMBL494499. Check out the elaboration below.
| DB13279 (Given Ligand) | CHEMBL494499 (Similar Ligand) |
|---|---|
| CCOC(=O)COc2ccc1c(C)c(CCN(CC)CC)c(=O)oc1c2 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@@H]2CCCCOC2)cc1 |
|
|
|
|
|
|
| 04000040 00202008 20180108 00010600 00051233 00400120 02000000 40000250 020a6080 40080840 0c240020 4040c000 40808402 00200080 01208081 10080808 00020220 82000040 08000002 00020200 00004000 1a200a08 04204008 89580010 08000410 80004000 00000039 0a900030 46002200 01060802 00000000 00000600 | 00000050 01c05409 2110050a 01b10700 00081080 00028000 02000000 a0000044 00542a00 004809e0 08342000 60018010 00008002 02a00101 81e80001 001a9008 10822000 02080000 00402800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000100e 00800000 102000ec 04000600 20060013 80000000 00012670 |