On Target RT_HIV1 0.3539326/CHEMBL4225028
For the given ligand DB06288, we have found in our database that, being scored 0.3539326, the most similar ligand is CHEMBL4225028. Check out the elaboration below.
| DB06288 (Given Ligand) | CHEMBL4225028 (Similar Ligand) |
|---|---|
| CCN1CCC[C@H]1CNC(=O)c2cc(S(=O)(=O)CC)c(N)cc2OC | C=C(C)[C@@H]1CC[C@]2(CNCCN3CCS(=O)(=O)CC3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000002 85807a08 a0124108 84910600 00001120 00030110 02000000 22001408 01020000 001148c0 08602005 60018040 00008802 08042000 812004c1 00002008 04000100 02000000 00010400 00022601 c0000000 38068620 20800021 0a58001d 00004000 c0000000 00800800 90000080 08000300 00060001 b4040000 40010220 | 00000000 45000800 20100302 4c150600 00000000 00004000 80000080 20000402 00020900 021c48c0 08302000 40018800 00028006 00242000 80000402 00080008 04000400 02010020 02012000 00000201 01000100 38020a30 00008261 06580014 01200000 80000000 00406000 d0000000 08400002 01060002 e4020000 02010620 |