On Target NS5B_HCV1A 0.3583815/CHEMBL363650
For the given ligand DB06288, we have found in our database that, being scored 0.3583815, the most similar ligand is CHEMBL363650. Check out the elaboration below.
| DB06288 (Given Ligand) | CHEMBL363650 (Similar Ligand) |
|---|---|
| CCN1CCC[C@H]1CNC(=O)c2cc(S(=O)(=O)CC)c(N)cc2OC | COc1ccc2c(O[C@H]3CC(C(=O)[C@@H](NC(=O)[C@@H](NC(C)=O)C4CCCCC4)C(C)C)[C@H](C(=O)CC4(C(=O)O)CC4)C3)ccnc2c1 |
|
|
|
|
|
|
| 00000002 85807a08 a0124108 84910600 00001120 00030110 02000000 22001408 01020000 001148c0 08602005 60018040 00008802 08042000 812004c1 00002008 04000100 02000000 00010400 00022601 c0000000 38068620 20800021 0a58001d 00004000 c0000000 00800800 90000080 08000300 00060001 b4040000 40010220 | 04050002 01003008 20104008 04010700 000c1000 02000000 06000000 20000008 00000000 000008c0 00200004 4001b000 0680883a 01c02001 91000041 000c200c 00800000 00000104 02602000 00060a01 40000000 38048e18 21800001 82100018 00000000 00000000 00000000 10000000 08000202 01060001 20064000 00202200 |