On Target NS5B_HCV1A 0.22672065/CHEMBL353549
For the given ligand DB13279, we have found in our database that, being scored 0.22672065, the most similar ligand is CHEMBL353549. Check out the elaboration below.
| DB13279 (Given Ligand) | CHEMBL353549 (Similar Ligand) |
|---|---|
| CCOC(=O)COc2ccc1c(C)c(CCN(CC)CC)c(=O)oc1c2 | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)c1ccc2c(c1)nc(-c1ccoc1)n2C1CCCCC1 |
|
|
|
|
|
|
| 04000040 00202008 20180108 00010600 00051233 00400120 02000000 40000250 020a6080 40080840 0c240020 4040c000 40808402 00200080 01208081 10080808 00020220 82000040 08000002 00020200 00004000 1a200a08 04204008 89580010 08000410 80004000 00000039 0a900030 46002200 01060802 00000000 00000600 | 0000800a 0120f890 00180100 51850612 200c10e1 00006000 00002000 0220100c 00424980 900918c0 0d30800c 4001b000 5e009c02 00c08800 000204c0 028c000c 10000008 02002004 02e02408 00400201 c0120100 38268e38 23800041 9158001c 00047801 c0004000 08400050 98800000 04400104 04460c43 e00cca00 000006a0 |