On Target NS5B_HCV1B 0.34033614/CHEMBL3645180
For the given ligand DB06288, we have found in our database that, being scored 0.34033614, the most similar ligand is CHEMBL3645180. Check out the elaboration below.
| DB06288 (Given Ligand) | CHEMBL3645180 (Similar Ligand) |
|---|---|
| CCN1CCC[C@H]1CNC(=O)c2cc(S(=O)(=O)CC)c(N)cc2OC | CCN(c1cc2nn(-c3ccc(Oc4ccccc4F)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00000002 85807a08 a0124108 84910600 00001120 00030110 02000000 22001408 01020000 001148c0 08602005 60018040 00008802 08042000 812004c1 00002008 04000100 02000000 00010400 00022601 c0000000 38068620 20800021 0a58001d 00004000 c0000000 00800800 90000080 08000300 00060001 b4040000 40010220 | 00004006 00805e08 2018090a 43310e00 010c1000 00004052 02040000 02001408 00100900 000908c0 09312024 40118800 80008c23 01401201 810a0841 000e200c 04268800 02000004 08602008 00224201 c0500101 3c838e38 20800800 8360001c 02104080 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |