On Target NS5B_HCV1B 0.22834645/CHEMBL3645202
For the given ligand DB01256, we have found in our database that, being scored 0.22834645, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| DB01256 (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| C=C[C@]5(C)C[C@@H](OC(=O)CS[C@H]1C[C@@H]2CC[C@H](C1)N2C)[C@@]3(C)[C@@H](C)CC[C@@]4(CCC(=O)[C@@H]34)[C@H](C)[C@H]5O | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00050000 81000000 00100101 80110740 00290000 00000030 00000000 20000400 04200000 001040c0 00203000 50079000 0401802a 80840000 00000414 00081008 04820000 00000100 12402000 00000201 40000020 10000a12 01000300 00300010 08008400 00000010 00000000 90003040 00000200 01040022 24020000 05012200 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |