On Target NS5B_HCV1B 0.280543/CHEMBL3645182
For the given ligand DB09164, we have found in our database that, being scored 0.280543, the most similar ligand is CHEMBL3645182. Check out the elaboration below.
| DB09164 (Given Ligand) | CHEMBL3645182 (Similar Ligand) |
|---|---|
| CC(C)c1cccc(C(C)C)c1NC(=O)CN(CC(=O)O)CC(=O)O | CNC(=O)c1c2cc(C3CC3)c(N(CCN3CCOCC3)S(C)(=O)=O)cc2nn1-c1ccc(Oc2ccc(F)cc2)cc1 |
|
|
|
|
|
|
| 00004002 00000000 00000120 04010600 00000081 00000040 00000000 00000000 00000000 00080a40 08282024 4000a000 02008002 00102003 00320040 00080008 10248000 02000000 08000000 00000000 40100000 28000e00 22002000 02400012 00000000 80000000 00000010 00801080 08088000 00060003 00004000 20000600 | 00004086 00805e08 2018092a c7310e00 010c1080 00004052 02060000 02001408 00100900 00090ac0 09312024 40118800 80008c23 01403201 811a1049 000ea10c 14268000 02000004 08602008 00624201 c0500101 3c838e38 32801800 a360003e 02104480 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |