On Target NS5B_HCV1B 0.20430107/CHEMBL3645188
For the given ligand DB13279, we have found in our database that, being scored 0.20430107, the most similar ligand is CHEMBL3645188. Check out the elaboration below.
| DB13279 (Given Ligand) | CHEMBL3645188 (Similar Ligand) |
|---|---|
| CCOC(=O)COc2ccc1c(C)c(CCN(CC)CC)c(=O)oc1c2 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3ccoc3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 04000040 00202008 20180108 00010600 00051233 00400120 02000000 40000250 020a6080 40080840 0c240020 4040c000 40808402 00200080 01208081 10080808 00020220 82000040 08000002 00020200 00004000 1a200a08 04204008 89580010 08000410 80004000 00000039 0a900030 46002200 01060802 00000000 00000600 | 00004006 00a0de08 20180902 41310e00 210c0001 00004042 02050000 02201418 00124900 004909e0 0d312024 40118c00 c0008c33 01400201 c08a4440 200e200e 04268000 02030004 08600008 00225203 e0100101 1c8b8e3e 2080c800 9368001c 02104084 c0004048 00670090 8880108c 0c488104 0046005b e4048088 a81147e0 |