On Target NA_INFB 0.3497537/CHEMBL4161935
For the given ligand DB06288, we have found in our database that, being scored 0.3497537, the most similar ligand is CHEMBL4161935. Check out the elaboration below.
| DB06288 (Given Ligand) | CHEMBL4161935 (Similar Ligand) |
|---|---|
| CCN1CCC[C@H]1CNC(=O)c2cc(S(=O)(=O)CC)c(N)cc2OC | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N(CC)CC)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00000002 85807a08 a0124108 84910600 00001120 00030110 02000000 22001408 01020000 001148c0 08602005 60018040 00008802 08042000 812004c1 00002008 04000100 02000000 00010400 00022601 c0000000 38068620 20800021 0a58001d 00004000 c0000000 00800800 90000080 08000300 00060001 b4040000 40010220 | 00074042 09007800 00100100 84010700 00180080 00000800 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00001448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |