On Target NA_INFB 0.27272728/CHEMBL195288
For the given ligand DB09164, we have found in our database that, being scored 0.27272728, the most similar ligand is CHEMBL195288. Check out the elaboration below.
| DB09164 (Given Ligand) | CHEMBL195288 (Similar Ligand) |
|---|---|
| CC(C)c1cccc(C(C)C)c1NC(=O)CN(CC(=O)O)CC(=O)O | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1ncc[nH]1 |
|
|
|
|
|
|
| 00004002 00000000 00000120 04010600 00000081 00000040 00000000 00000000 00000000 00080a40 08282024 4000a000 02008002 00102003 00320040 00080008 10248000 02000000 08000000 00000000 40100000 28000e00 22002000 02400012 00000000 80000000 00000010 00801080 08088000 00060003 00004000 20000600 | 0401000a 01003000 00100420 14000400 000800c0 00000010 01000020 20000008 00000100 00000280 00208000 40013000 0600801a 01802001 811a0000 000c000c 10000000 0c000000 00402008 00000201 20100000 30040e30 23000001 02100018 00001000 00000000 00000000 10000180 08000004 00c60801 40024000 20802a00 |