On Target NA_INFB 0.21585903/CHEMBL348066
For the given ligand DB13279, we have found in our database that, being scored 0.21585903, the most similar ligand is CHEMBL348066. Check out the elaboration below.
| DB13279 (Given Ligand) | CHEMBL348066 (Similar Ligand) |
|---|---|
| CCOC(=O)COc2ccc1c(C)c(CCN(CC)CC)c(=O)oc1c2 | CCCN(CCc1ccccc1)C(=O)[C@@H]1OC(C(=O)O)=C[C@H](N)[C@H]1NC(=O)C(F)(F)F |
|
|
|
|
|
|
| 04000040 00202008 20180108 00010600 00051233 00400120 02000000 40000250 020a6080 40080840 0c240020 4040c000 40808402 00200080 01208081 10080808 00020220 82000040 08000002 00020200 00004000 1a200a08 04204008 89580010 08000410 80004000 00000039 0a900030 46002200 01060802 00000000 00000600 | 00030000 89007600 00100101 80010701 00000081 000003c0 00080180 38800c04 01200080 801889e8 88200000 4003d200 8c028002 00480000 02081408 38099008 30200004 82000141 40c14010 00002205 00004020 382a0f80 17008000 8b70001c 00001400 80000c00 00c04000 90000121 0c004200 00060413 0c040000 00006600 |