On Target NP_HCoV-OC43 0.19875777/CHEMBL3233481
For the given ligand DB06288, we have found in our database that, being scored 0.19875777, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| DB06288 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCN1CCC[C@H]1CNC(=O)c2cc(S(=O)(=O)CC)c(N)cc2OC | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000002 85807a08 a0124108 84910600 00001120 00030110 02000000 22001408 01020000 001148c0 08602005 60018040 00008802 08042000 812004c1 00002008 04000100 02000000 00010400 00022601 c0000000 38068620 20800021 0a58001d 00004000 c0000000 00800800 90000080 08000300 00060001 b4040000 40010220 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |