On Target PLP_SARS 0.27218935/CHEMBL213054
For the given ligand DB01256, we have found in our database that, being scored 0.27218935, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| DB01256 (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| C=C[C@]5(C)C[C@@H](OC(=O)CS[C@H]1C[C@@H]2CC[C@H](C1)N2C)[C@@]3(C)[C@@H](C)CC[C@@]4(CCC(=O)[C@@H]34)[C@H](C)[C@H]5O | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00050000 81000000 00100101 80110740 00290000 00000030 00000000 20000400 04200000 001040c0 00203000 50079000 0401802a 80840000 00000414 00081008 04820000 00000100 12402000 00000201 40000020 10000a12 01000300 00300010 08008400 00000010 00000000 90003040 00000200 01040022 24020000 05012200 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |