On Target PLP_SARS 0.24102564/CHEMBL426898
For the given ligand DB13279, we have found in our database that, being scored 0.24102564, the most similar ligand is CHEMBL426898. Check out the elaboration below.
| DB13279 (Given Ligand) | CHEMBL426898 (Similar Ligand) |
|---|---|
| CCOC(=O)COc2ccc1c(C)c(CCN(CC)CC)c(=O)oc1c2 | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2o1 |
|
|
|
|
|
|
| 04000040 00202008 20180108 00010600 00051233 00400120 02000000 40000250 020a6080 40080840 0c240020 4040c000 40808402 00200080 01208081 10080808 00020220 82000040 08000002 00020200 00004000 1a200a08 04204008 89580010 08000410 80004000 00000039 0a900030 46002200 01060802 00000000 00000600 | 04108002 00200808 60084109 00010200 00041200 04004004 80080000 41200200 02004100 20000840 00000124 4004a800 46808c0c 08010082 01030022 020c000c 00024000 02002000 00200008 00020000 40000000 08068b28 30800000 00c89204 28002c40 a0082380 04000214 08000000 00002281 01020000 c0005000 10020000 |