On Target NS3_HCV1A 0.3164557/CHEMBL3645759
For the given ligand DB00833, we have found in our database that, being scored 0.3164557, the most similar ligand is CHEMBL3645759. Check out the elaboration below.
| DB00833 (Given Ligand) | CHEMBL3645759 (Similar Ligand) |
|---|---|
| N[C@@H](C(=O)N[C@@H]1C(=O)N2/C(C(=O)O)=C(Cl)\CS[C@H]12)c3ccccc3 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](OC)c1ccccc1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 08400080 40006000 20124100 0c310640 01000080 00000000 002083a0 1000940c 11000480 0a0e4842 08210003 4004b000 0b01c806 000c2105 c0190001 0048004c 14000400 02000280 00010018 02700328 4000a000 3d208f80 02000203 87402018 04001200 a8000060 00404000 00040550 0c000030 c0562123 24046011 a3130680 | 000100a0 09003000 06100100 05210600 00000080 00004010 000a0000 20001408 10000180 0018c9c8 08602000 4001f000 0701801a 01012013 e0581400 02080008 14004000 82000000 46012000 00004201 00000000 38240630 12000003 b3d00038 00000000 80002000 00000000 90000011 0c000200 c0060083 64026004 00012660 |