On Target NS3_HCV1A 0.26041666/CHEMBL3645746
For the given ligand DB00955, we have found in our database that, being scored 0.26041666, the most similar ligand is CHEMBL3645746. Check out the elaboration below.
| DB00955 (Given Ligand) | CHEMBL3645746 (Similar Ligand) |
|---|---|
| CCN[C@H]2C[C@@H](N)[C@@H](O[C@H]1O/C(CN)=C\C[C@@H]1N)[C@@H](O)[C@H]2O[C@@H]3OC[C@@](C)(O)[C@@H](NC)[C@H]3O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)CC1CCCCO1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00000050 81000400 00100101 80010501 803800c0 00000000 000a3880 28000400 00200000 015001e0 00200000 40018000 80020002 03880000 02001008 002b9308 30a00044 00000140 13c0e000 00002201 00100020 100000b0 17008080 08100010 30000421 80000000 00400200 b4000021 00004202 00040010 0ce40000 00004a00 | 000100e0 09003000 06100100 05210500 800c0000 00200010 000a0000 20001408 10000000 0010c188 00602000 4001b000 1601801a 01882011 a0400400 00081008 04204000 00000000 46c12000 00004201 00000020 30040630 01000083 32900038 00000401 00000000 00000000 90000010 08000200 c0040081 64024004 00012260 |