On Target ACE2_HUMAN 0.15853658/CHEMBL254900
For the given ligand DB00367, we have found in our database that, being scored 0.15853658, the most similar ligand is CHEMBL254900. Check out the elaboration below.
| DB00367 (Given Ligand) | CHEMBL254900 (Similar Ligand) |
|---|---|
| C#C[C@@]4(O)CC[C@H]3[C@H]2CC/C1=C/C(=O)CC[C@@H]1[C@@H]2CC[C@@]34CC | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](C)C(=O)O |
|
|
|
|
|
|
| 00010000 01000000 00000000 00000000 00482000 00000000 00000080 00000402 01000000 00108000 00000080 40001000 04028008 00800000 00000400 00090008 00000000 00000020 02412000 00000001 00000008 00000280 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000200 24020800 00000000 | 00010000 01004000 00100000 00100400 00000080 00000000 80000000 20000000 00000000 02080080 00200000 40013000 06008002 00040000 80080000 00080008 10000000 00000000 00000000 00000201 00000000 10000e00 03000100 04100018 00000000 00000000 00000000 10000040 00000000 00040001 20004000 03010200 |