On Target PA_INFA 0.20704846/CHEMBL2040640
For the given ligand DB00562, we have found in our database that, being scored 0.20704846, the most similar ligand is CHEMBL2040640. Check out the elaboration below.
| DB00562 (Given Ligand) | CHEMBL2040640 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1Cl)/N=C(CSCc2ccccc2)\NS3(=O)=O | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCCN(S(=O)(=O)Cc2ccccc2)C1 |
|
|
|
|
|
|
| 0200c012 40802208 21002508 01b10620 00088013 14010000 18001010 00002c01 40800000 8000c843 00002004 60008800 42421006 40040009 802200c0 20018008 04002d08 02040100 01400000 01007000 c0000000 18000100 20000200 08504408 060c6000 88080004 500804a0 0800087c 00080400 62860000 00000002 06030160 | 00018000 05000220 00102102 01310600 00000000 00000000 00000084 28008400 11000800 007808c4 08302418 5001d800 8e029036 00240001 80400400 000c0008 0000400c 02000100 00252018 00004a01 80000100 1c800b90 04008000 10500030 02003800 80002400 00444000 9000000c 04004002 0006008a 24000000 00032670 |