On Target PR_HIV1 0.19642857/CHEMBL449291
For the given ligand DB00833, we have found in our database that, being scored 0.19642857, the most similar ligand is CHEMBL449291. Check out the elaboration below.
| DB00833 (Given Ligand) | CHEMBL449291 (Similar Ligand) |
|---|---|
| N[C@@H](C(=O)N[C@@H]1C(=O)N2/C(C(=O)O)=C(Cl)\CS[C@H]12)c3ccccc3 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCS(=O)(=O)CCOC2)cc1 |
|
|
|
|
|
|
| 08400080 40006000 20124100 0c310640 01000080 00000000 002083a0 1000940c 11000480 0a0e4842 08210003 4004b000 0b01c806 000c2105 c0190001 0048004c 14000400 02000280 00010018 02700328 4000a000 3d208f80 02000203 87402018 04001200 a8000060 00404000 00040550 0c000030 c0562123 24046011 a3130680 | 00000010 05c05409 2110050b 01b10600 000810c0 00028020 02000000 20000044 00542a00 014849e0 0830b000 60018010 00008002 80240001 81e80011 001a0008 14022000 02080000 01400800 01027603 80000120 18280c90 07100240 d9500058 02020400 8000001e 00800020 102020ec 04000600 22060013 80000000 04012670 |