On Target PR_HIV1 0.28773585/CHEMBL3645129
For the given ligand DB00955, we have found in our database that, being scored 0.28773585, the most similar ligand is CHEMBL3645129. Check out the elaboration below.
| DB00955 (Given Ligand) | CHEMBL3645129 (Similar Ligand) |
|---|---|
| CCN[C@H]2C[C@@H](N)[C@@H](O[C@H]1O/C(CN)=C\C[C@@H]1N)[C@@H](O)[C@H]2O[C@@H]3OC[C@@](C)(O)[C@@H](NC)[C@H]3O | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC1CC2OCO[C@@H]2C1)S(=O)(=O)c1ccc(CO)cc1 |
|
|
|
|
|
|
| 00000050 81000400 00100101 80010501 803800c0 00000000 000a3880 28000400 00200000 015001e0 00200000 40018000 80020002 03880000 02001008 002b9308 30a00044 00000140 13c0e000 00002201 00100020 100000b0 17008080 08100010 30000421 80000000 00400200 b4000021 00004202 00040010 0ce40000 00004a00 | 00000010 01c05400 01100102 01b10700 00280088 0002c004 00000800 a8000004 00740b00 014809e0 08302000 60018000 00008002 02200101 80e80000 003a0008 10822000 02080000 11408800 01007603 80000100 18380cb0 07100040 d9500058 02000000 8000100e 00000000 3420002c 04000600 2106001b c0a00000 00012670 |